C34H44F2N2O3S — CID 123623322
2-[[3-[2-[4-(1,1-difluoroprop-2-enylsulfanyl)cyclohexa-1,3-dien-1-yl]-2-oxoethyl]cyclohexyl]methyl]-N-(2-methoxyethyl)-3,7-dimethyl-3,4-dihydro-2-benzazepine-8-carboxamide (PubChem CID 123623322) has the molecular formula C34H44F2N2O3S and a molecular weight of 598.80 g/mol. Its IUPAC name is 2-[[3-[2-[4-(1,1-difluoroprop-2-enylsulfanyl)cyclohexa-1,3-dien-1-yl]-2-oxoethyl]cyclohexyl]methyl]-N-(2-methoxyethyl)-3,7-dimethyl-3,4-dihydro-2-benzazepine-8-carboxamide.
| Compound Name | 2-[[3-[2-[4-(1,1-difluoroprop-2-enylsulfanyl)cyclohexa-1,3-dien-1-yl]-2-oxoethyl]cyclohexyl]methyl]-N-(2-methoxyethyl)-3,7-dimethyl-3,4-dihydro-2-benzazepine-8-carboxamide |
|---|---|
| PubChem CID | 123623322 |
| Molecular Formula | C34H44F2N2O3S |
| Molecular Weight | 598.80 g/mol |
| Exact Mass | 598.30 |
| IUPAC Name | 2-[[3-[2-[4-(1,1-difluoroprop-2-enylsulfanyl)cyclohexa-1,3-dien-1-yl]-2-oxoethyl]cyclohexyl]methyl]-N-(2-methoxyethyl)-3,7-dimethyl-3,4-dihydro-2-benzazepine-8-carboxamide |
| SMILES | C=CC(F)(F)SC1=CC=C(C(=O)CC2CCCC(CN3C=c4cc(C(=O)NCCOC)c(C)cc4=CCC3C)C2)CC1 |
| InChI | InChI=1S/C34H44F2N2O3S/c1-5-34(35,36)42-30-13-11-27(12-14-30)32(39)19-25-7-6-8-26(18-25)21-38-22-29-20-31(33(40)37-15-16-41-4)23(2)17-28(29)10-9-24(38)3/h5,10-11,13,17,20,22,24-26H,1,6-9,12,14-16,18-19,21H2,2-4H3,(H,37,40) |
| InChIKey | HENNLXSVSOCXIP-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.80 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|