C24H27ClN4O — CID 123623329
N-[3-[6-(4-chloro-6-ethyl-3-methyl-2-pyridinyl)-2-pyridinyl]propoxy]-1-(6-methyl-2-pyridinyl)ethanimine (PubChem CID 123623329) has the molecular formula C24H27ClN4O and a molecular weight of 422.96 g/mol. Its IUPAC name is N-[3-[6-(4-chloro-6-ethyl-3-methyl-2-pyridinyl)-2-pyridinyl]propoxy]-1-(6-methyl-2-pyridinyl)ethanimine.
| Compound Name | N-[3-[6-(4-chloro-6-ethyl-3-methyl-2-pyridinyl)-2-pyridinyl]propoxy]-1-(6-methyl-2-pyridinyl)ethanimine |
|---|---|
| PubChem CID | 123623329 |
| Molecular Formula | C24H27ClN4O |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | N-[3-[6-(4-chloro-6-ethyl-3-methyl-2-pyridinyl)-2-pyridinyl]propoxy]-1-(6-methyl-2-pyridinyl)ethanimine |
| SMILES | CCc1cc(Cl)c(C)c(-c2cccc(CCCON=C(C)c3cccc(C)n3)n2)n1 |
| InChI | InChI=1S/C24H27ClN4O/c1-5-19-15-21(25)17(3)24(28-19)23-13-7-10-20(27-23)11-8-14-30-29-18(4)22-12-6-9-16(2)26-22/h6-7,9-10,12-13,15H,5,8,11,14H2,1-4H3 |
| InChIKey | HWRJOKNVBIMMDA-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 60.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|