C22H24FNO5 — CID 123623677
4-fluoro-2-(4-hydroxyoxan-3-yl)-5-methoxy-6-[(4-methoxyphenyl)methyl]-3H-isoindol-1-one (PubChem CID 123623677) has the molecular formula C22H24FNO5 and a molecular weight of 401.43 g/mol. Its IUPAC name is 4-fluoro-2-(4-hydroxyoxan-3-yl)-5-methoxy-6-[(4-methoxyphenyl)methyl]-3H-isoindol-1-one.
| Compound Name | 4-fluoro-2-(4-hydroxyoxan-3-yl)-5-methoxy-6-[(4-methoxyphenyl)methyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 123623677 |
| Molecular Formula | C22H24FNO5 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 4-fluoro-2-(4-hydroxyoxan-3-yl)-5-methoxy-6-[(4-methoxyphenyl)methyl]-3H-isoindol-1-one |
| SMILES | COc1ccc(Cc2cc3c(c(F)c2OC)CN(C2COCCC2O)C3=O)cc1 |
| InChI | InChI=1S/C22H24FNO5/c1-27-15-5-3-13(4-6-15)9-14-10-16-17(20(23)21(14)28-2)11-24(22(16)26)18-12-29-8-7-19(18)25/h3-6,10,18-19,25H,7-9,11-12H2,1-2H3 |
| InChIKey | UEWHVJSFCSTFKS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |