C16H17F3N3+ — CID 123623870
4,5-difluoro-2-(6-fluoro-1-methyl-3H-azepin-1-ium-4-yl)-3-methyl-6,7-dihydro-5H-cyclohepta[d]imidazole (PubChem CID 123623870) has the molecular formula C16H17F3N3+ and a molecular weight of 308.33 g/mol. Its IUPAC name is 4,5-difluoro-2-(6-fluoro-1-methyl-3H-azepin-1-ium-4-yl)-3-methyl-6,7-dihydro-5H-cyclohepta[d]imidazole.
| Compound Name | 4,5-difluoro-2-(6-fluoro-1-methyl-3H-azepin-1-ium-4-yl)-3-methyl-6,7-dihydro-5H-cyclohepta[d]imidazole |
|---|---|
| PubChem CID | 123623870 |
| Molecular Formula | C16H17F3N3+ |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 4,5-difluoro-2-(6-fluoro-1-methyl-3H-azepin-1-ium-4-yl)-3-methyl-6,7-dihydro-5H-cyclohepta[d]imidazole |
| SMILES | Cn1c(C2=CC(F)=C[N+](C)=CC2)nc2c1=C(F)C(F)CCC=2 |
| InChI | InChI=1S/C16H17F3N3/c1-21-7-6-10(8-11(17)9-21)16-20-13-5-3-4-12(18)14(19)15(13)22(16)2/h5,7-9,12H,3-4,6H2,1-2H3/q+1 |
| InChIKey | MJEIYEDLYLXRPZ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 20.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|