C28H9F8N5 — CID 123623908
(2Z)-2-[(4Z)-3-(N-(3,5-difluorophenyl)-3,5-difluoroanilino)-4-isocyanoiminocyclohexa-2,5-dien-1-ylidene]-2-(2,3,5,6-tetrafluoro-4-isocyanophenyl)acetonitrile (PubChem CID 123623908) has the molecular formula C28H9F8N5 and a molecular weight of 567.40 g/mol. Its IUPAC name is (2Z)-2-[(4Z)-3-(N-(3,5-difluorophenyl)-3,5-difluoroanilino)-4-isocyanoiminocyclohexa-2,5-dien-1-ylidene]-2-(2,3,5,6-tetrafluoro-4-isocyanophenyl)acetonitrile.
| Compound Name | (2Z)-2-[(4Z)-3-(N-(3,5-difluorophenyl)-3,5-difluoroanilino)-4-isocyanoiminocyclohexa-2,5-dien-1-ylidene]-2-(2,3,5,6-tetrafluoro-4-isocyanophenyl)acetonitrile |
|---|---|
| PubChem CID | 123623908 |
| Molecular Formula | C28H9F8N5 |
| Molecular Weight | 567.40 g/mol |
| Exact Mass | 567.07 |
| IUPAC Name | (2Z)-2-[(4Z)-3-(N-(3,5-difluorophenyl)-3,5-difluoroanilino)-4-isocyanoiminocyclohexa-2,5-dien-1-ylidene]-2-(2,3,5,6-tetrafluoro-4-isocyanophenyl)acetonitrile |
| SMILES | [C-]#[N+]/N=C1/C=C/C(=C(/C#N)c2c(F)c(F)c([N+]#[C-])c(F)c2F)C=C1N(c1cc(F)cc(F)c1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C28H9F8N5/c1-38-28-26(35)24(33)23(25(34)27(28)36)20(12-37)13-3-4-21(40-39-2)22(5-13)41(18-8-14(29)6-15(30)9-18)19-10-16(31)7-17(32)11-19/h3-11H/b20-13+,40-21- |
| InChIKey | ACVRVMYWABIZGR-QEWMOGKESA-N |
| XLogP | 8.19 |
| TPSA | 48.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.40 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_quin_methide(10)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|