About 2-chloro-3-fluoro-5,6-dimethyloctane
2-chloro-3-fluoro-5,6-dimethyloctane (PubChem CID 123624502) has the molecular formula C10H20ClF
and a molecular weight of 194.72 g/mol. Its IUPAC name is 2-chloro-3-fluoro-5,6-dimethyloctane.
Molecular Properties
| Compound Name | 2-chloro-3-fluoro-5,6-dimethyloctane |
| PubChem CID | 123624502 |
| Molecular Formula | C10H20ClF |
| Molecular Weight | 194.72 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 2-chloro-3-fluoro-5,6-dimethyloctane |
| SMILES | CCC(C)C(C)CC(F)C(C)Cl |
| InChI | InChI=1S/C10H20ClF/c1-5-7(2)8(3)6-10(12)9(4)11/h7-10H,5-6H2,1-4H3 |
| InChIKey | FWXQDYPPBHLFJG-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.72 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-fluoro-5,6-dimethyloctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-fluoro-5,6-dimethyloctane?
The IUPAC name of 2-chloro-3-fluoro-5,6-dimethyloctane (CID 123624502) is 2-chloro-3-fluoro-5,6-dimethyloctane.
What is the SMILES notation for 2-chloro-3-fluoro-5,6-dimethyloctane?
The canonical SMILES for 2-chloro-3-fluoro-5,6-dimethyloctane is CCC(C)C(C)CC(F)C(C)Cl.
What is the InChIKey of 2-chloro-3-fluoro-5,6-dimethyloctane?
The InChIKey is FWXQDYPPBHLFJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20ClF/c1-5-7(2)8(3)6-10(12)9(4)11/h7-10H,5-6H2,1-4H3.
What are the key properties of 2-chloro-3-fluoro-5,6-dimethyloctane?
2-chloro-3-fluoro-5,6-dimethyloctane has a molecular weight of 194.72 g/mol, XLogP of 4.02, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-fluoro-5,6-dimethyloctane is sourced from PubChem (CID 123624502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).