About 5-butyl-2-methoxy-6,8,8-trimethylnon-2-ene
5-butyl-2-methoxy-6,8,8-trimethylnon-2-ene (PubChem CID 123624714) has the molecular formula C17H34O
and a molecular weight of 254.46 g/mol. Its IUPAC name is 5-butyl-2-methoxy-6,8,8-trimethylnon-2-ene.
Molecular Properties
| Compound Name | 5-butyl-2-methoxy-6,8,8-trimethylnon-2-ene |
| PubChem CID | 123624714 |
| Molecular Formula | C17H34O |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.26 |
| IUPAC Name | 5-butyl-2-methoxy-6,8,8-trimethylnon-2-ene |
| SMILES | CCCCC(CC=C(C)OC)C(C)CC(C)(C)C |
| InChI | InChI=1S/C17H34O/c1-8-9-10-16(12-11-15(3)18-7)14(2)13-17(4,5)6/h11,14,16H,8-10,12-13H2,1-7H3 |
| InChIKey | JJNGJUULVQUOFK-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 5-butyl-2-methoxy-6,8,8-trimethylnon-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-2-methoxy-6,8,8-trimethylnon-2-ene?
The IUPAC name of 5-butyl-2-methoxy-6,8,8-trimethylnon-2-ene (CID 123624714) is 5-butyl-2-methoxy-6,8,8-trimethylnon-2-ene.
What is the SMILES notation for 5-butyl-2-methoxy-6,8,8-trimethylnon-2-ene?
The canonical SMILES for 5-butyl-2-methoxy-6,8,8-trimethylnon-2-ene is CCCCC(CC=C(C)OC)C(C)CC(C)(C)C.
What is the InChIKey of 5-butyl-2-methoxy-6,8,8-trimethylnon-2-ene?
The InChIKey is JJNGJUULVQUOFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O/c1-8-9-10-16(12-11-15(3)18-7)14(2)13-17(4,5)6/h11,14,16H,8-10,12-13H2,1-7H3.
What are the key properties of 5-butyl-2-methoxy-6,8,8-trimethylnon-2-ene?
5-butyl-2-methoxy-6,8,8-trimethylnon-2-ene has a molecular weight of 254.46 g/mol, XLogP of 5.81, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-2-methoxy-6,8,8-trimethylnon-2-ene is sourced from PubChem (CID 123624714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).