C22H35NOS — CID 123625261
2-(2-adamantylsulfanyl)-N-(3,7-dimethylocta-2,6-dienyl)acetamide (PubChem CID 123625261) has the molecular formula C22H35NOS and a molecular weight of 361.60 g/mol. Its IUPAC name is 2-(2-adamantylsulfanyl)-N-(3,7-dimethylocta-2,6-dienyl)acetamide.
| Compound Name | 2-(2-adamantylsulfanyl)-N-(3,7-dimethylocta-2,6-dienyl)acetamide |
|---|---|
| PubChem CID | 123625261 |
| Molecular Formula | C22H35NOS |
| Molecular Weight | 361.60 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | 2-(2-adamantylsulfanyl)-N-(3,7-dimethylocta-2,6-dienyl)acetamide |
| SMILES | CC(C)=CCCC(C)=CCNC(=O)CSC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C22H35NOS/c1-15(2)5-4-6-16(3)7-8-23-21(24)14-25-22-19-10-17-9-18(12-19)13-20(22)11-17/h5,7,17-20,22H,4,6,8-14H2,1-3H3,(H,23,24) |
| InChIKey | QJHAZQDYEKIHHA-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.60 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|