C24H22FN7O3 — CID 123625513
1-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[2-[hydroxy(phenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethane-1,2-dione (PubChem CID 123625513) has the molecular formula C24H22FN7O3 and a molecular weight of 475.48 g/mol. Its IUPAC name is 1-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[2-[hydroxy(phenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethane-1,2-dione.
| Compound Name | 1-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[2-[hydroxy(phenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 123625513 |
| Molecular Formula | C24H22FN7O3 |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 1-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[2-[hydroxy(phenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CC2CN(C(O)c3ccccc3)CC2C1)c1c[nH]c2c(-n3ccnn3)ncc(F)c12 |
| InChI | InChI=1S/C24H22FN7O3/c25-18-9-27-22(32-7-6-28-29-32)20-19(18)17(8-26-20)21(33)24(35)31-12-15-10-30(11-16(15)13-31)23(34)14-4-2-1-3-5-14/h1-9,15-16,23,26,34H,10-13H2 |
| InChIKey | ZVOCFAWWFOKBQF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|