C21H31F2N3O3S — CID 123626319
2-(2,5-difluorophenyl)-5-(1-propan-2-ylsulfonyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl)oxan-3-amine (PubChem CID 123626319) has the molecular formula C21H31F2N3O3S and a molecular weight of 443.56 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-5-(1-propan-2-ylsulfonyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl)oxan-3-amine.
| Compound Name | 2-(2,5-difluorophenyl)-5-(1-propan-2-ylsulfonyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl)oxan-3-amine |
|---|---|
| PubChem CID | 123626319 |
| Molecular Formula | C21H31F2N3O3S |
| Molecular Weight | 443.56 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 2-(2,5-difluorophenyl)-5-(1-propan-2-ylsulfonyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl)oxan-3-amine |
| SMILES | CC(C)S(=O)(=O)N1CCCC2CN(C3COC(c4cc(F)ccc4F)C(N)C3)CC21 |
| InChI | InChI=1S/C21H31F2N3O3S/c1-13(2)30(27,28)26-7-3-4-14-10-25(11-20(14)26)16-9-19(24)21(29-12-16)17-8-15(22)5-6-18(17)23/h5-6,8,13-14,16,19-21H,3-4,7,9-12,24H2,1-2H3 |
| InChIKey | VTCLHXQONGRILE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.56 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |