About ethenyl-dimethyl-(3,3,3-trifluoropropylsilyloxy)silane
ethenyl-dimethyl-(3,3,3-trifluoropropylsilyloxy)silane (PubChem CID 123626406) has the molecular formula C7H15F3OSi2
and a molecular weight of 228.36 g/mol. Its IUPAC name is ethenyl-dimethyl-(3,3,3-trifluoropropylsilyloxy)silane.
Molecular Properties
| Compound Name | ethenyl-dimethyl-(3,3,3-trifluoropropylsilyloxy)silane |
| PubChem CID | 123626406 |
| Molecular Formula | C7H15F3OSi2 |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | ethenyl-dimethyl-(3,3,3-trifluoropropylsilyloxy)silane |
| SMILES | C=C[Si](C)(C)O[SiH2]CCC(F)(F)F |
| InChI | InChI=1S/C7H15F3OSi2/c1-4-13(2,3)11-12-6-5-7(8,9)10/h4H,1,5-6,12H2,2-3H3 |
| InChIKey | AXGCXWGPEXYKOB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethenyl-dimethyl-(3,3,3-trifluoropropylsilyloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl-dimethyl-(3,3,3-trifluoropropylsilyloxy)silane?
The IUPAC name of ethenyl-dimethyl-(3,3,3-trifluoropropylsilyloxy)silane (CID 123626406) is ethenyl-dimethyl-(3,3,3-trifluoropropylsilyloxy)silane.
What is the SMILES notation for ethenyl-dimethyl-(3,3,3-trifluoropropylsilyloxy)silane?
The canonical SMILES for ethenyl-dimethyl-(3,3,3-trifluoropropylsilyloxy)silane is C=C[Si](C)(C)O[SiH2]CCC(F)(F)F.
What is the InChIKey of ethenyl-dimethyl-(3,3,3-trifluoropropylsilyloxy)silane?
The InChIKey is AXGCXWGPEXYKOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15F3OSi2/c1-4-13(2,3)11-12-6-5-7(8,9)10/h4H,1,5-6,12H2,2-3H3.
What are the key properties of ethenyl-dimethyl-(3,3,3-trifluoropropylsilyloxy)silane?
ethenyl-dimethyl-(3,3,3-trifluoropropylsilyloxy)silane has a molecular weight of 228.36 g/mol, XLogP of 2.39, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl-dimethyl-(3,3,3-trifluoropropylsilyloxy)silane is sourced from PubChem (CID 123626406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).