About 4-(2,4-dimethylheptan-2-yloxy)-2,3-dimethylbutan-2-amine
4-(2,4-dimethylheptan-2-yloxy)-2,3-dimethylbutan-2-amine (PubChem CID 123626972) has the molecular formula C15H33NO
and a molecular weight of 243.43 g/mol. Its IUPAC name is 4-(2,4-dimethylheptan-2-yloxy)-2,3-dimethylbutan-2-amine.
Molecular Properties
| Compound Name | 4-(2,4-dimethylheptan-2-yloxy)-2,3-dimethylbutan-2-amine |
| PubChem CID | 123626972 |
| Molecular Formula | C15H33NO |
| Molecular Weight | 243.43 g/mol |
| Exact Mass | 243.26 |
| IUPAC Name | 4-(2,4-dimethylheptan-2-yloxy)-2,3-dimethylbutan-2-amine |
| SMILES | CCCC(C)CC(C)(C)OCC(C)C(C)(C)N |
| InChI | InChI=1S/C15H33NO/c1-8-9-12(2)10-14(4,5)17-11-13(3)15(6,7)16/h12-13H,8-11,16H2,1-7H3 |
| InChIKey | KFIIAGSTYIFEJF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2,4-dimethylheptan-2-yloxy)-2,3-dimethylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-dimethylheptan-2-yloxy)-2,3-dimethylbutan-2-amine?
The IUPAC name of 4-(2,4-dimethylheptan-2-yloxy)-2,3-dimethylbutan-2-amine (CID 123626972) is 4-(2,4-dimethylheptan-2-yloxy)-2,3-dimethylbutan-2-amine.
What is the SMILES notation for 4-(2,4-dimethylheptan-2-yloxy)-2,3-dimethylbutan-2-amine?
The canonical SMILES for 4-(2,4-dimethylheptan-2-yloxy)-2,3-dimethylbutan-2-amine is CCCC(C)CC(C)(C)OCC(C)C(C)(C)N.
What is the InChIKey of 4-(2,4-dimethylheptan-2-yloxy)-2,3-dimethylbutan-2-amine?
The InChIKey is KFIIAGSTYIFEJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H33NO/c1-8-9-12(2)10-14(4,5)17-11-13(3)15(6,7)16/h12-13H,8-11,16H2,1-7H3.
What are the key properties of 4-(2,4-dimethylheptan-2-yloxy)-2,3-dimethylbutan-2-amine?
4-(2,4-dimethylheptan-2-yloxy)-2,3-dimethylbutan-2-amine has a molecular weight of 243.43 g/mol, XLogP of 3.98, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dimethylheptan-2-yloxy)-2,3-dimethylbutan-2-amine is sourced from PubChem (CID 123626972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).