C17H18N6O2 — CID 123627315
1-(3-hydroxycyclopentyl)-3-imino-1-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]propan-2-one (PubChem CID 123627315) has the molecular formula C17H18N6O2 and a molecular weight of 338.37 g/mol. Its IUPAC name is 1-(3-hydroxycyclopentyl)-3-imino-1-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]propan-2-one.
| Compound Name | 1-(3-hydroxycyclopentyl)-3-imino-1-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]propan-2-one |
|---|---|
| PubChem CID | 123627315 |
| Molecular Formula | C17H18N6O2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 1-(3-hydroxycyclopentyl)-3-imino-1-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrazol-1-yl]propan-2-one |
| SMILES | [H]/N=C/C(=O)C(C1CCC(O)C1)n1cc(-c2ncnc3[nH]ccc23)cn1 |
| InChI | InChI=1S/C17H18N6O2/c18-6-14(25)16(10-1-2-12(24)5-10)23-8-11(7-22-23)15-13-3-4-19-17(13)21-9-20-15/h3-4,6-10,12,16,18,24H,1-2,5H2,(H,19,20,21)/b18-6+ |
| InChIKey | YGCRGPPGHSBHTI-NGYBGAFCSA-N |
| XLogP | 1.74 |
| TPSA | 120.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|