About N'-(3-methylbut-2-enyl)-N-prop-2-enylpropane-1,3-diamine
N'-(3-methylbut-2-enyl)-N-prop-2-enylpropane-1,3-diamine (PubChem CID 123627492) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is N'-(3-methylbut-2-enyl)-N-prop-2-enylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(3-methylbut-2-enyl)-N-prop-2-enylpropane-1,3-diamine |
| PubChem CID | 123627492 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | N'-(3-methylbut-2-enyl)-N-prop-2-enylpropane-1,3-diamine |
| SMILES | C=CCNCCCNCC=C(C)C |
| InChI | InChI=1S/C11H22N2/c1-4-7-12-8-5-9-13-10-6-11(2)3/h4,6,12-13H,1,5,7-10H2,2-3H3 |
| InChIKey | IYQUVTSXQTUWSM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N'-(3-methylbut-2-enyl)-N-prop-2-enylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3-methylbut-2-enyl)-N-prop-2-enylpropane-1,3-diamine?
The IUPAC name of N'-(3-methylbut-2-enyl)-N-prop-2-enylpropane-1,3-diamine (CID 123627492) is N'-(3-methylbut-2-enyl)-N-prop-2-enylpropane-1,3-diamine.
What is the SMILES notation for N'-(3-methylbut-2-enyl)-N-prop-2-enylpropane-1,3-diamine?
The canonical SMILES for N'-(3-methylbut-2-enyl)-N-prop-2-enylpropane-1,3-diamine is C=CCNCCCNCC=C(C)C.
What is the InChIKey of N'-(3-methylbut-2-enyl)-N-prop-2-enylpropane-1,3-diamine?
The InChIKey is IYQUVTSXQTUWSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2/c1-4-7-12-8-5-9-13-10-6-11(2)3/h4,6,12-13H,1,5,7-10H2,2-3H3.
What are the key properties of N'-(3-methylbut-2-enyl)-N-prop-2-enylpropane-1,3-diamine?
N'-(3-methylbut-2-enyl)-N-prop-2-enylpropane-1,3-diamine has a molecular weight of 182.31 g/mol, XLogP of 1.71, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3-methylbut-2-enyl)-N-prop-2-enylpropane-1,3-diamine is sourced from PubChem (CID 123627492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).