C8H18B2O4 — CID 123627872
dimethoxy-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)borane (PubChem CID 123627872) has the molecular formula C8H18B2O4 and a molecular weight of 199.85 g/mol. Its IUPAC name is dimethoxy-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)borane.
| Compound Name | dimethoxy-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)borane |
|---|---|
| PubChem CID | 123627872 |
| Molecular Formula | C8H18B2O4 |
| Molecular Weight | 199.85 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | dimethoxy-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)borane |
| SMILES | COB(OC)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C8H18B2O4/c1-7(2)8(3,4)14-10(13-7)9(11-5)12-6/h1-6H3 |
| InChIKey | IXIFIANBGXTKKT-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.85 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|