C35H35F5N2 — CID 123628168
2,7-bis(4-fluorophenyl)-4-methyl-3-[2-methylidene-3-[3-(trifluoromethyl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl]butyl]-4,5-dihydro-1,3-diazepine (PubChem CID 123628168) has the molecular formula C35H35F5N2 and a molecular weight of 578.67 g/mol. Its IUPAC name is 2,7-bis(4-fluorophenyl)-4-methyl-3-[2-methylidene-3-[3-(trifluoromethyl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl]butyl]-4,5-dihydro-1,3-diazepine.
| Compound Name | 2,7-bis(4-fluorophenyl)-4-methyl-3-[2-methylidene-3-[3-(trifluoromethyl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl]butyl]-4,5-dihydro-1,3-diazepine |
|---|---|
| PubChem CID | 123628168 |
| Molecular Formula | C35H35F5N2 |
| Molecular Weight | 578.67 g/mol |
| Exact Mass | 578.27 |
| IUPAC Name | 2,7-bis(4-fluorophenyl)-4-methyl-3-[2-methylidene-3-[3-(trifluoromethyl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl]butyl]-4,5-dihydro-1,3-diazepine |
| SMILES | C=C(CN1C(c2ccc(F)cc2)=NC(c2ccc(F)cc2)=CCC1C)C(C)C1CCc2ccc(C(F)(F)F)cc2CC1 |
| InChI | InChI=1S/C35H35F5N2/c1-22(24(3)25-5-7-26-9-14-30(35(38,39)40)20-29(26)8-6-25)21-42-23(2)4-19-33(27-10-15-31(36)16-11-27)41-34(42)28-12-17-32(37)18-13-28/h9-20,23-25H,1,4-8,21H2,2-3H3 |
| InChIKey | QJMMTOKQQOYGJC-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.67 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|