About (E)-N-ethenyl-N'-methyl-3-(1-methylpyrrol-2-yl)prop-2-enimidamide
(E)-N-ethenyl-N'-methyl-3-(1-methylpyrrol-2-yl)prop-2-enimidamide (PubChem CID 123628198) has the molecular formula C11H15N3
and a molecular weight of 189.26 g/mol. Its IUPAC name is (E)-N-ethenyl-N'-methyl-3-(1-methylpyrrol-2-yl)prop-2-enimidamide.
Molecular Properties
| Compound Name | (E)-N-ethenyl-N'-methyl-3-(1-methylpyrrol-2-yl)prop-2-enimidamide |
| PubChem CID | 123628198 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | (E)-N-ethenyl-N'-methyl-3-(1-methylpyrrol-2-yl)prop-2-enimidamide |
| SMILES | C=CNC(/C=C/c1cccn1C)=N\C |
| InChI | InChI=1S/C11H15N3/c1-4-13-11(12-2)8-7-10-6-5-9-14(10)3/h4-9H,1H2,2-3H3,(H,12,13)/b8-7+ |
| InChIKey | HQUUQXFPTRUAOM-BQYQJAHWSA-N |
| XLogP | 1.80 |
| TPSA | 29.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-ethenyl-N'-methyl-3-(1-methylpyrrol-2-yl)prop-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-ethenyl-N'-methyl-3-(1-methylpyrrol-2-yl)prop-2-enimidamide?
The IUPAC name of (E)-N-ethenyl-N'-methyl-3-(1-methylpyrrol-2-yl)prop-2-enimidamide (CID 123628198) is (E)-N-ethenyl-N'-methyl-3-(1-methylpyrrol-2-yl)prop-2-enimidamide.
What is the SMILES notation for (E)-N-ethenyl-N'-methyl-3-(1-methylpyrrol-2-yl)prop-2-enimidamide?
The canonical SMILES for (E)-N-ethenyl-N'-methyl-3-(1-methylpyrrol-2-yl)prop-2-enimidamide is C=CNC(/C=C/c1cccn1C)=N\C.
What is the InChIKey of (E)-N-ethenyl-N'-methyl-3-(1-methylpyrrol-2-yl)prop-2-enimidamide?
The InChIKey is HQUUQXFPTRUAOM-BQYQJAHWSA-N. The full InChI is InChI=1S/C11H15N3/c1-4-13-11(12-2)8-7-10-6-5-9-14(10)3/h4-9H,1H2,2-3H3,(H,12,13)/b8-7+.
What are the key properties of (E)-N-ethenyl-N'-methyl-3-(1-methylpyrrol-2-yl)prop-2-enimidamide?
(E)-N-ethenyl-N'-methyl-3-(1-methylpyrrol-2-yl)prop-2-enimidamide has a molecular weight of 189.26 g/mol, XLogP of 1.80, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-ethenyl-N'-methyl-3-(1-methylpyrrol-2-yl)prop-2-enimidamide is sourced from PubChem (CID 123628198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).