About 3-phenyl-1,4-dihydrochromeno[3,4-d]pyrazole
3-phenyl-1,4-dihydrochromeno[3,4-d]pyrazole (PubChem CID 1236282) has the molecular formula C16H12N2O
and a molecular weight of 248.29 g/mol. Its IUPAC name is 3-phenyl-1,4-dihydrochromeno[3,4-d]pyrazole.
Molecular Properties
| Compound Name | 3-phenyl-1,4-dihydrochromeno[3,4-d]pyrazole |
| PubChem CID | 1236282 |
| Molecular Formula | C16H12N2O |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 3-phenyl-1,4-dihydrochromeno[3,4-d]pyrazole |
| SMILES | c1ccc(-c2n[nH]c3c2COc2ccccc2-3)cc1 |
| InChI | InChI=1S/C16H12N2O/c1-2-6-11(7-3-1)15-13-10-19-14-9-5-4-8-12(14)16(13)18-17-15/h1-9H,10H2,(H,17,18) |
| InChIKey | ARXFBCCVCDACKG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-phenyl-1,4-dihydrochromeno[3,4-d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-1,4-dihydrochromeno[3,4-d]pyrazole?
The IUPAC name of 3-phenyl-1,4-dihydrochromeno[3,4-d]pyrazole (CID 1236282) is 3-phenyl-1,4-dihydrochromeno[3,4-d]pyrazole.
What is the SMILES notation for 3-phenyl-1,4-dihydrochromeno[3,4-d]pyrazole?
The canonical SMILES for 3-phenyl-1,4-dihydrochromeno[3,4-d]pyrazole is c1ccc(-c2n[nH]c3c2COc2ccccc2-3)cc1.
What is the InChIKey of 3-phenyl-1,4-dihydrochromeno[3,4-d]pyrazole?
The InChIKey is ARXFBCCVCDACKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2O/c1-2-6-11(7-3-1)15-13-10-19-14-9-5-4-8-12(14)16(13)18-17-15/h1-9H,10H2,(H,17,18).
What are the key properties of 3-phenyl-1,4-dihydrochromeno[3,4-d]pyrazole?
3-phenyl-1,4-dihydrochromeno[3,4-d]pyrazole has a molecular weight of 248.29 g/mol, XLogP of 3.64, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-1,4-dihydrochromeno[3,4-d]pyrazole is sourced from PubChem (CID 1236282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).