About 6-tert-butyl-5-ethenyl-2-methoxy-8,8-dimethylnona-2,4-diene
6-tert-butyl-5-ethenyl-2-methoxy-8,8-dimethylnona-2,4-diene (PubChem CID 123628290) has the molecular formula C18H32O
and a molecular weight of 264.45 g/mol. Its IUPAC name is 6-tert-butyl-5-ethenyl-2-methoxy-8,8-dimethylnona-2,4-diene.
Molecular Properties
| Compound Name | 6-tert-butyl-5-ethenyl-2-methoxy-8,8-dimethylnona-2,4-diene |
| PubChem CID | 123628290 |
| Molecular Formula | C18H32O |
| Molecular Weight | 264.45 g/mol |
| Exact Mass | 264.25 |
| IUPAC Name | 6-tert-butyl-5-ethenyl-2-methoxy-8,8-dimethylnona-2,4-diene |
| SMILES | C=CC(=CC=C(C)OC)C(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H32O/c1-10-15(12-11-14(2)19-9)16(18(6,7)8)13-17(3,4)5/h10-12,16H,1,13H2,2-9H3 |
| InChIKey | QCEMRLSZUBZUQT-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.45 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 6-tert-butyl-5-ethenyl-2-methoxy-8,8-dimethylnona-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-5-ethenyl-2-methoxy-8,8-dimethylnona-2,4-diene?
The IUPAC name of 6-tert-butyl-5-ethenyl-2-methoxy-8,8-dimethylnona-2,4-diene (CID 123628290) is 6-tert-butyl-5-ethenyl-2-methoxy-8,8-dimethylnona-2,4-diene.
What is the SMILES notation for 6-tert-butyl-5-ethenyl-2-methoxy-8,8-dimethylnona-2,4-diene?
The canonical SMILES for 6-tert-butyl-5-ethenyl-2-methoxy-8,8-dimethylnona-2,4-diene is C=CC(=CC=C(C)OC)C(CC(C)(C)C)C(C)(C)C.
What is the InChIKey of 6-tert-butyl-5-ethenyl-2-methoxy-8,8-dimethylnona-2,4-diene?
The InChIKey is QCEMRLSZUBZUQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32O/c1-10-15(12-11-14(2)19-9)16(18(6,7)8)13-17(3,4)5/h10-12,16H,1,13H2,2-9H3.
What are the key properties of 6-tert-butyl-5-ethenyl-2-methoxy-8,8-dimethylnona-2,4-diene?
6-tert-butyl-5-ethenyl-2-methoxy-8,8-dimethylnona-2,4-diene has a molecular weight of 264.45 g/mol, XLogP of 5.75, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-5-ethenyl-2-methoxy-8,8-dimethylnona-2,4-diene is sourced from PubChem (CID 123628290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).