C14H21N7O2S — CID 123628599
5-[(3-aminooxan-4-yl)amino]-3-[(3-methyl-4,5-dihydro-1,2-thiazol-5-yl)amino]pyrazine-2-carboxamide (PubChem CID 123628599) has the molecular formula C14H21N7O2S and a molecular weight of 351.44 g/mol. Its IUPAC name is 5-[(3-aminooxan-4-yl)amino]-3-[(3-methyl-4,5-dihydro-1,2-thiazol-5-yl)amino]pyrazine-2-carboxamide.
| Compound Name | 5-[(3-aminooxan-4-yl)amino]-3-[(3-methyl-4,5-dihydro-1,2-thiazol-5-yl)amino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 123628599 |
| Molecular Formula | C14H21N7O2S |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 5-[(3-aminooxan-4-yl)amino]-3-[(3-methyl-4,5-dihydro-1,2-thiazol-5-yl)amino]pyrazine-2-carboxamide |
| SMILES | CC1=NSC(Nc2nc(NC3CCOCC3N)cnc2C(N)=O)C1 |
| InChI | InChI=1S/C14H21N7O2S/c1-7-4-11(24-21-7)20-14-12(13(16)22)17-5-10(19-14)18-9-2-3-23-6-8(9)15/h5,8-9,11H,2-4,6,15H2,1H3,(H2,16,22)(H2,18,19,20) |
| InChIKey | KSXVRJSYTARPPU-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 140.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|