About butylamino [(2R,5S)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate
butylamino [(2R,5S)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (PubChem CID 123628631) has the molecular formula C11H18N4O5S
and a molecular weight of 318.36 g/mol. Its IUPAC name is butylamino [(2R,5S)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate.
Molecular Properties
| Compound Name | butylamino [(2R,5S)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| PubChem CID | 123628631 |
| Molecular Formula | C11H18N4O5S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | butylamino [(2R,5S)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| SMILES | [C-]#[N+][C@@H]1CC[C@H]2CN1C(=O)N2OS(=O)(=O)ONCCCC |
| InChI | InChI=1S/C11H18N4O5S/c1-3-4-7-13-19-21(17,18)20-15-9-5-6-10(12-2)14(8-9)11(15)16/h9-10,13H,3-8H2,1H3/t9-,10-/m0/s1 |
| InChIKey | GKWVOTIEEZOPGM-UWVGGRQHSA-N |
| XLogP | 0.63 |
| TPSA | 92.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze butylamino [(2R,5S)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butylamino [(2R,5S)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate?
The IUPAC name of butylamino [(2R,5S)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (CID 123628631) is butylamino [(2R,5S)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate.
What is the SMILES notation for butylamino [(2R,5S)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate?
The canonical SMILES for butylamino [(2R,5S)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate is [C-]#[N+][C@@H]1CC[C@H]2CN1C(=O)N2OS(=O)(=O)ONCCCC.
What is the InChIKey of butylamino [(2R,5S)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate?
The InChIKey is GKWVOTIEEZOPGM-UWVGGRQHSA-N. The full InChI is InChI=1S/C11H18N4O5S/c1-3-4-7-13-19-21(17,18)20-15-9-5-6-10(12-2)14(8-9)11(15)16/h9-10,13H,3-8H2,1H3/t9-,10-/m0/s1.
What are the key properties of butylamino [(2R,5S)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate?
butylamino [(2R,5S)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate has a molecular weight of 318.36 g/mol, XLogP of 0.63, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for butylamino [(2R,5S)-2-isocyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate is sourced from PubChem (CID 123628631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).