C22H29N5O — CID 123628846
4-[[6-imino-1-[2-(1-methylpyrrolidin-3-yl)ethanimidoyl]-3-pyridinyl]oxy]-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 123628846) has the molecular formula C22H29N5O and a molecular weight of 379.51 g/mol. Its IUPAC name is 4-[[6-imino-1-[2-(1-methylpyrrolidin-3-yl)ethanimidoyl]-3-pyridinyl]oxy]-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | 4-[[6-imino-1-[2-(1-methylpyrrolidin-3-yl)ethanimidoyl]-3-pyridinyl]oxy]-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 123628846 |
| Molecular Formula | C22H29N5O |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | 4-[[6-imino-1-[2-(1-methylpyrrolidin-3-yl)ethanimidoyl]-3-pyridinyl]oxy]-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | [H]/N=C(\CC1CCN(C)C1)n1cc(OC2CCC(N)c3ccccc32)cc/c1=N\[H] |
| InChI | InChI=1S/C22H29N5O/c1-26-11-10-15(13-26)12-22(25)27-14-16(6-9-21(27)24)28-20-8-7-19(23)17-4-2-3-5-18(17)20/h2-6,9,14-15,19-20,24-25H,7-8,10-13,23H2,1H3/b24-21+,25-22+ |
| InChIKey | MXEJXZHMRYTPON-VNABVMDTSA-N |
| XLogP | 3.05 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|