C6H10F3NO2S — CID 123629088
3,3-dimethyl-1-(trifluoromethylsulfonyl)azetidine (PubChem CID 123629088) has the molecular formula C6H10F3NO2S and a molecular weight of 217.21 g/mol. Its IUPAC name is 3,3-dimethyl-1-(trifluoromethylsulfonyl)azetidine.
| Compound Name | 3,3-dimethyl-1-(trifluoromethylsulfonyl)azetidine |
|---|---|
| PubChem CID | 123629088 |
| Molecular Formula | C6H10F3NO2S |
| Molecular Weight | 217.21 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 3,3-dimethyl-1-(trifluoromethylsulfonyl)azetidine |
| SMILES | CC1(C)CN(S(=O)(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C6H10F3NO2S/c1-5(2)3-10(4-5)13(11,12)6(7,8)9/h3-4H2,1-2H3 |
| InChIKey | AWZHZDNPOCLIPC-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.21 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |