C34H30F3N5O3 — CID 123629322
9-(5-hydroxy-1H-indol-2-yl)-1-[4-[4-(1-hydroxypropyl)piperazin-1-yl]-3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one (PubChem CID 123629322) has the molecular formula C34H30F3N5O3 and a molecular weight of 613.64 g/mol. Its IUPAC name is 9-(5-hydroxy-1H-indol-2-yl)-1-[4-[4-(1-hydroxypropyl)piperazin-1-yl]-3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one.
| Compound Name | 9-(5-hydroxy-1H-indol-2-yl)-1-[4-[4-(1-hydroxypropyl)piperazin-1-yl]-3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one |
|---|---|
| PubChem CID | 123629322 |
| Molecular Formula | C34H30F3N5O3 |
| Molecular Weight | 613.64 g/mol |
| Exact Mass | 613.23 |
| IUPAC Name | 9-(5-hydroxy-1H-indol-2-yl)-1-[4-[4-(1-hydroxypropyl)piperazin-1-yl]-3-(trifluoromethyl)phenyl]benzo[h][1,6]naphthyridin-2-one |
| SMILES | CCC(O)N1CCN(c2ccc(-n3c(=O)ccc4cnc5ccc(-c6cc7cc(O)ccc7[nH]6)cc5c43)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C34H30F3N5O3/c1-2-31(44)41-13-11-40(12-14-41)30-9-5-23(18-26(30)34(35,36)37)42-32(45)10-4-21-19-38-28-7-3-20(16-25(28)33(21)42)29-17-22-15-24(43)6-8-27(22)39-29/h3-10,15-19,31,39,43-44H,2,11-14H2,1H3 |
| InChIKey | JXGRCBHBMYVMHC-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.64 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|