About N-phenyl-1,2-dihydroacenaphthylen-5-amine
N-phenyl-1,2-dihydroacenaphthylen-5-amine (PubChem CID 1236299) has the molecular formula C18H15N
and a molecular weight of 245.33 g/mol. Its IUPAC name is N-phenyl-1,2-dihydroacenaphthylen-5-amine.
Molecular Properties
| Compound Name | N-phenyl-1,2-dihydroacenaphthylen-5-amine |
| PubChem CID | 1236299 |
| Molecular Formula | C18H15N |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | N-phenyl-1,2-dihydroacenaphthylen-5-amine |
| SMILES | c1ccc(Nc2ccc3c4c(cccc24)CC3)cc1 |
| InChI | InChI=1S/C18H15N/c1-2-6-15(7-3-1)19-17-12-11-14-10-9-13-5-4-8-16(17)18(13)14/h1-8,11-12,19H,9-10H2 |
| InChIKey | XVVRBGXWPDPMBY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-phenyl-1,2-dihydroacenaphthylen-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyl-1,2-dihydroacenaphthylen-5-amine?
The IUPAC name of N-phenyl-1,2-dihydroacenaphthylen-5-amine (CID 1236299) is N-phenyl-1,2-dihydroacenaphthylen-5-amine.
What is the SMILES notation for N-phenyl-1,2-dihydroacenaphthylen-5-amine?
The canonical SMILES for N-phenyl-1,2-dihydroacenaphthylen-5-amine is c1ccc(Nc2ccc3c4c(cccc24)CC3)cc1.
What is the InChIKey of N-phenyl-1,2-dihydroacenaphthylen-5-amine?
The InChIKey is XVVRBGXWPDPMBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N/c1-2-6-15(7-3-1)19-17-12-11-14-10-9-13-5-4-8-16(17)18(13)14/h1-8,11-12,19H,9-10H2.
What are the key properties of N-phenyl-1,2-dihydroacenaphthylen-5-amine?
N-phenyl-1,2-dihydroacenaphthylen-5-amine has a molecular weight of 245.33 g/mol, XLogP of 4.68, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-1,2-dihydroacenaphthylen-5-amine is sourced from PubChem (CID 1236299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).