C22H20FN2S+ — CID 123629922
2-(4-fluorophenyl)-5-methyl-4-(2,3,5-trimethylphenyl)-[1,3]thiazolo[4,5-c]pyridin-5-ium (PubChem CID 123629922) has the molecular formula C22H20FN2S+ and a molecular weight of 363.48 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-methyl-4-(2,3,5-trimethylphenyl)-[1,3]thiazolo[4,5-c]pyridin-5-ium.
| Compound Name | 2-(4-fluorophenyl)-5-methyl-4-(2,3,5-trimethylphenyl)-[1,3]thiazolo[4,5-c]pyridin-5-ium |
|---|---|
| PubChem CID | 123629922 |
| Molecular Formula | C22H20FN2S+ |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 2-(4-fluorophenyl)-5-methyl-4-(2,3,5-trimethylphenyl)-[1,3]thiazolo[4,5-c]pyridin-5-ium |
| SMILES | Cc1cc(C)c(C)c(-c2c3nc(-c4ccc(F)cc4)sc3cc[n+]2C)c1 |
| InChI | InChI=1S/C22H20FN2S/c1-13-11-14(2)15(3)18(12-13)21-20-19(9-10-25(21)4)26-22(24-20)16-5-7-17(23)8-6-16/h5-12H,1-4H3/q+1 |
| InChIKey | LQSWCYLYMYTCSW-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|