C35H40F3N3O4S — CID 123630105
N-[2-[3-[1-(benzenesulfonyl)-6-methylpiperazin-2-yl]propyl]-3-fluorophenyl]-2-[4-(3,4-difluorophenyl)oxan-4-yl]but-3-enamide (PubChem CID 123630105) has the molecular formula C35H40F3N3O4S and a molecular weight of 655.78 g/mol. Its IUPAC name is N-[2-[3-[1-(benzenesulfonyl)-6-methylpiperazin-2-yl]propyl]-3-fluorophenyl]-2-[4-(3,4-difluorophenyl)oxan-4-yl]but-3-enamide.
| Compound Name | N-[2-[3-[1-(benzenesulfonyl)-6-methylpiperazin-2-yl]propyl]-3-fluorophenyl]-2-[4-(3,4-difluorophenyl)oxan-4-yl]but-3-enamide |
|---|---|
| PubChem CID | 123630105 |
| Molecular Formula | C35H40F3N3O4S |
| Molecular Weight | 655.78 g/mol |
| Exact Mass | 655.27 |
| IUPAC Name | N-[2-[3-[1-(benzenesulfonyl)-6-methylpiperazin-2-yl]propyl]-3-fluorophenyl]-2-[4-(3,4-difluorophenyl)oxan-4-yl]but-3-enamide |
| SMILES | C=CC(C(=O)Nc1cccc(F)c1CCCC1CNCC(C)N1S(=O)(=O)c1ccccc1)C1(c2ccc(F)c(F)c2)CCOCC1 |
| InChI | InChI=1S/C35H40F3N3O4S/c1-3-29(35(17-19-45-20-18-35)25-15-16-31(37)32(38)21-25)34(42)40-33-14-8-13-30(36)28(33)12-7-9-26-23-39-22-24(2)41(26)46(43,44)27-10-5-4-6-11-27/h3-6,8,10-11,13-16,21,24,26,29,39H,1,7,9,12,17-20,22-23H2,2H3,(H,40,42) |
| InChIKey | IQCGXIMASPEPLB-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.78 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|