C34H38N8O2 — CID 123631932
N-[3-[3-[6-acetyl-7-amino-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octan-8-yl]-3-oxoprop-1-en-2-yl]-N'-butan-2-ylmethanimidamide (PubChem CID 123631932) has the molecular formula C34H38N8O2 and a molecular weight of 590.73 g/mol. Its IUPAC name is N-[3-[3-[6-acetyl-7-amino-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octan-8-yl]-3-oxoprop-1-en-2-yl]-N'-butan-2-ylmethanimidamide.
| Compound Name | N-[3-[3-[6-acetyl-7-amino-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octan-8-yl]-3-oxoprop-1-en-2-yl]-N'-butan-2-ylmethanimidamide |
|---|---|
| PubChem CID | 123631932 |
| Molecular Formula | C34H38N8O2 |
| Molecular Weight | 590.73 g/mol |
| Exact Mass | 590.31 |
| IUPAC Name | N-[3-[3-[6-acetyl-7-amino-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-8-azabicyclo[3.2.1]octan-8-yl]-3-oxoprop-1-en-2-yl]-N'-butan-2-ylmethanimidamide |
| SMILES | C=C(N/C=N/C(C)CC)C(=O)N1C2CCC1CC(c1nc3c(-c4ccc(-c5ccccc5)nc4)cnn3c(N)c1C(C)=O)C2 |
| InChI | InChI=1S/C34H38N8O2/c1-5-20(2)37-19-38-21(3)34(44)41-26-12-13-27(41)16-25(15-26)31-30(22(4)43)32(35)42-33(40-31)28(18-39-42)24-11-14-29(36-17-24)23-9-7-6-8-10-23/h6-11,14,17-20,25-27H,3,5,12-13,15-16,35H2,1-2,4H3,(H,37,38) |
| InChIKey | OGCCRRSLDWADNW-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 130.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.73 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|