C16H25N7O — CID 123631961
2-[3-[4-(6-methyl-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl)-3,6-dihydro-2H-pyridin-1-yl]propyl]guanidine (PubChem CID 123631961) has the molecular formula C16H25N7O and a molecular weight of 331.42 g/mol. Its IUPAC name is 2-[3-[4-(6-methyl-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl)-3,6-dihydro-2H-pyridin-1-yl]propyl]guanidine.
| Compound Name | 2-[3-[4-(6-methyl-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl)-3,6-dihydro-2H-pyridin-1-yl]propyl]guanidine |
|---|---|
| PubChem CID | 123631961 |
| Molecular Formula | C16H25N7O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | 2-[3-[4-(6-methyl-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl)-3,6-dihydro-2H-pyridin-1-yl]propyl]guanidine |
| SMILES | CC1=CC2=CN(C3=CCN(CCCN=C(N)N)CC3)C(=O)NC2N1 |
| InChI | InChI=1S/C16H25N7O/c1-11-9-12-10-23(16(24)21-14(12)20-11)13-3-7-22(8-4-13)6-2-5-19-15(17)18/h3,9-10,14,20H,2,4-8H2,1H3,(H,21,24)(H4,17,18,19) |
| InChIKey | NLYNOFJMEJSDTL-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|