About spiro[4.6]undec-2-ene
spiro[4.6]undec-2-ene (PubChem CID 123632667) has the molecular formula C11H18
and a molecular weight of 150.27 g/mol. Its IUPAC name is spiro[4.6]undec-2-ene.
Molecular Properties
| Compound Name | spiro[4.6]undec-2-ene |
| PubChem CID | 123632667 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.27 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | spiro[4.6]undec-2-ene |
| SMILES | C1=CCC2(C1)CCCCCC2 |
| InChI | InChI=1S/C11H18/c1-2-4-8-11(7-3-1)9-5-6-10-11/h5-6H,1-4,7-10H2 |
| InChIKey | FRUAVHYHSBOAOT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.27 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze spiro[4.6]undec-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[4.6]undec-2-ene?
The IUPAC name of spiro[4.6]undec-2-ene (CID 123632667) is spiro[4.6]undec-2-ene.
What is the SMILES notation for spiro[4.6]undec-2-ene?
The canonical SMILES for spiro[4.6]undec-2-ene is C1=CCC2(C1)CCCCCC2.
What is the InChIKey of spiro[4.6]undec-2-ene?
The InChIKey is FRUAVHYHSBOAOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18/c1-2-4-8-11(7-3-1)9-5-6-10-11/h5-6H,1-4,7-10H2.
What are the key properties of spiro[4.6]undec-2-ene?
spiro[4.6]undec-2-ene has a molecular weight of 150.27 g/mol, XLogP of 3.68, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[4.6]undec-2-ene is sourced from PubChem (CID 123632667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).