C33H56 — CID 123633267
2,7-ditert-butyl-9-[1-(3-prop-2-enylcyclopentyl)cyclobutyl]-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene (PubChem CID 123633267) has the molecular formula C33H56 and a molecular weight of 452.81 g/mol. Its IUPAC name is 2,7-ditert-butyl-9-[1-(3-prop-2-enylcyclopentyl)cyclobutyl]-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene.
| Compound Name | 2,7-ditert-butyl-9-[1-(3-prop-2-enylcyclopentyl)cyclobutyl]-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene |
|---|---|
| PubChem CID | 123633267 |
| Molecular Formula | C33H56 |
| Molecular Weight | 452.81 g/mol |
| Exact Mass | 452.44 |
| IUPAC Name | 2,7-ditert-butyl-9-[1-(3-prop-2-enylcyclopentyl)cyclobutyl]-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene |
| SMILES | C=CCC1CCC(C2(C3C4CC(C(C)(C)C)CCC4C4CCC(C(C)(C)C)CC43)CCC2)C1 |
| InChI | InChI=1S/C33H56/c1-8-10-22-11-12-25(19-22)33(17-9-18-33)30-28-20-23(31(2,3)4)13-15-26(28)27-16-14-24(21-29(27)30)32(5,6)7/h8,22-30H,1,9-21H2,2-7H3 |
| InChIKey | ISYWAEVMEHFUQK-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.81 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|