C21H23ClFNO — CID 123633305
(4-amino-3-methylphenyl)-[6-chloro-3-(1-cyclopropyl-2-methylpropyl)-2-fluorophenyl]methanone (PubChem CID 123633305) has the molecular formula C21H23ClFNO and a molecular weight of 359.87 g/mol. Its IUPAC name is (4-amino-3-methylphenyl)-[6-chloro-3-(1-cyclopropyl-2-methylpropyl)-2-fluorophenyl]methanone.
| Compound Name | (4-amino-3-methylphenyl)-[6-chloro-3-(1-cyclopropyl-2-methylpropyl)-2-fluorophenyl]methanone |
|---|---|
| PubChem CID | 123633305 |
| Molecular Formula | C21H23ClFNO |
| Molecular Weight | 359.87 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | (4-amino-3-methylphenyl)-[6-chloro-3-(1-cyclopropyl-2-methylpropyl)-2-fluorophenyl]methanone |
| SMILES | Cc1cc(C(=O)c2c(Cl)ccc(C(C(C)C)C3CC3)c2F)ccc1N |
| InChI | InChI=1S/C21H23ClFNO/c1-11(2)18(13-4-5-13)15-7-8-16(22)19(20(15)23)21(25)14-6-9-17(24)12(3)10-14/h6-11,13,18H,4-5,24H2,1-3H3 |
| InChIKey | XMTPEVILEYFTKG-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.87 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|