C17H23N — CID 123633722
1-methylidene-2-(1-methylidene-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-2-yl)pyridin-1-ium-2-ide (PubChem CID 123633722) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is 1-methylidene-2-(1-methylidene-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-2-yl)pyridin-1-ium-2-ide.
| Compound Name | 1-methylidene-2-(1-methylidene-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-2-yl)pyridin-1-ium-2-ide |
|---|---|
| PubChem CID | 123633722 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 1-methylidene-2-(1-methylidene-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-2-yl)pyridin-1-ium-2-ide |
| SMILES | C=C1C([C-]2C=CC=C[N+]2=C)CCC2CCCCC12 |
| InChI | InChI=1S/C17H23N/c1-13-15-8-4-3-7-14(15)10-11-16(13)17-9-5-6-12-18(17)2/h5-6,9,12,14-16H,1-4,7-8,10-11H2 |
| InChIKey | AKFXTQVKUSJPOK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|