C20H32O14S3 — CID 123633737
3-[2-ethyl-4-methoxycarbonyl-6-methyl-3,5-bis(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid (PubChem CID 123633737) has the molecular formula C20H32O14S3 and a molecular weight of 592.66 g/mol. Its IUPAC name is 3-[2-ethyl-4-methoxycarbonyl-6-methyl-3,5-bis(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid.
| Compound Name | 3-[2-ethyl-4-methoxycarbonyl-6-methyl-3,5-bis(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 123633737 |
| Molecular Formula | C20H32O14S3 |
| Molecular Weight | 592.66 g/mol |
| Exact Mass | 592.10 |
| IUPAC Name | 3-[2-ethyl-4-methoxycarbonyl-6-methyl-3,5-bis(3-sulfopropoxy)phenoxy]propane-1-sulfonic acid |
| SMILES | CCc1c(OCCCS(=O)(=O)O)c(C)c(OCCCS(=O)(=O)O)c(C(=O)OC)c1OCCCS(=O)(=O)O |
| InChI | InChI=1S/C20H32O14S3/c1-4-15-17(32-8-5-11-35(22,23)24)14(2)18(33-9-6-12-36(25,26)27)16(20(21)31-3)19(15)34-10-7-13-37(28,29)30/h4-13H2,1-3H3,(H,22,23,24)(H,25,26,27)(H,28,29,30) |
| InChIKey | VRECRXOEZRSMPC-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 217.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.66 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|