C29H31BN7O+ — CID 123634057
CID 123634057 (PubChem CID 123634057) has the molecular formula C29H31BN7O+ and a molecular weight of 504.43 g/mol.
| Compound Name | CID 123634057 |
|---|---|
| PubChem CID | 123634057 |
| Molecular Formula | C29H31BN7O+ |
| Molecular Weight | 504.43 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | — |
| SMILES | [B][n+]1cccc(-c2ccnc(Nc3cc(NC(=O)c4ccc(CN5CCN(C)CC5)cc4)ccc3C)n2)c1 |
| InChI | InChI=1S/C29H31BN7O/c1-21-5-10-25(18-27(21)34-29-31-12-11-26(33-29)24-4-3-13-37(30)20-24)32-28(38)23-8-6-22(7-9-23)19-36-16-14-35(2)15-17-36/h3-13,18,20H,14-17,19H2,1-2H3,(H,32,38)(H,31,33,34)/q+1 |
| InChIKey | DUIXPORWVVSFSQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 77.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|