About N-(2-aminopropyl)-N'-methylprop-2-enimidamide
N-(2-aminopropyl)-N'-methylprop-2-enimidamide (PubChem CID 123634791) has the molecular formula C7H15N3
and a molecular weight of 141.22 g/mol. Its IUPAC name is N-(2-aminopropyl)-N'-methylprop-2-enimidamide.
Molecular Properties
| Compound Name | N-(2-aminopropyl)-N'-methylprop-2-enimidamide |
| PubChem CID | 123634791 |
| Molecular Formula | C7H15N3 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | N-(2-aminopropyl)-N'-methylprop-2-enimidamide |
| SMILES | C=C/C(=N\C)NCC(C)N |
| InChI | InChI=1S/C7H15N3/c1-4-7(9-3)10-5-6(2)8/h4,6H,1,5,8H2,2-3H3,(H,9,10) |
| InChIKey | QMMOEPPBTKLMIW-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminopropyl)-N'-methylprop-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminopropyl)-N'-methylprop-2-enimidamide?
The IUPAC name of N-(2-aminopropyl)-N'-methylprop-2-enimidamide (CID 123634791) is N-(2-aminopropyl)-N'-methylprop-2-enimidamide.
What is the SMILES notation for N-(2-aminopropyl)-N'-methylprop-2-enimidamide?
The canonical SMILES for N-(2-aminopropyl)-N'-methylprop-2-enimidamide is C=C/C(=N\C)NCC(C)N.
What is the InChIKey of N-(2-aminopropyl)-N'-methylprop-2-enimidamide?
The InChIKey is QMMOEPPBTKLMIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3/c1-4-7(9-3)10-5-6(2)8/h4,6H,1,5,8H2,2-3H3,(H,9,10).
What are the key properties of N-(2-aminopropyl)-N'-methylprop-2-enimidamide?
N-(2-aminopropyl)-N'-methylprop-2-enimidamide has a molecular weight of 141.22 g/mol, XLogP of 0.14, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminopropyl)-N'-methylprop-2-enimidamide is sourced from PubChem (CID 123634791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).