C12H14N2O5 — CID 123635016
(4R,5R)-2-(4-methoxyphenyl)-1,3-dioxolane-4,5-dicarboxamide (PubChem CID 123635016) has the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. Its IUPAC name is (4R,5R)-2-(4-methoxyphenyl)-1,3-dioxolane-4,5-dicarboxamide.
| Compound Name | (4R,5R)-2-(4-methoxyphenyl)-1,3-dioxolane-4,5-dicarboxamide |
|---|---|
| PubChem CID | 123635016 |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | (4R,5R)-2-(4-methoxyphenyl)-1,3-dioxolane-4,5-dicarboxamide |
| SMILES | COc1ccc(C2O[C@@H](C(N)=O)[C@H](C(N)=O)O2)cc1 |
| InChI | InChI=1S/C12H14N2O5/c1-17-7-4-2-6(3-5-7)12-18-8(10(13)15)9(19-12)11(14)16/h2-5,8-9,12H,1H3,(H2,13,15)(H2,14,16)/t8-,9-/m1/s1 |
| InChIKey | JKDBCIPMVUJNGZ-RKDXNWHRSA-N |
| XLogP | -0.55 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |