C19H30N2O — CID 123635276
(3E,6Z,8Z)-2-methanimidoyl-4,7-dimethyl-5-methylidene-N-propyldodeca-3,6,8-trienamide (PubChem CID 123635276) has the molecular formula C19H30N2O and a molecular weight of 302.46 g/mol. Its IUPAC name is (3E,6Z,8Z)-2-methanimidoyl-4,7-dimethyl-5-methylidene-N-propyldodeca-3,6,8-trienamide.
| Compound Name | (3E,6Z,8Z)-2-methanimidoyl-4,7-dimethyl-5-methylidene-N-propyldodeca-3,6,8-trienamide |
|---|---|
| PubChem CID | 123635276 |
| Molecular Formula | C19H30N2O |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | (3E,6Z,8Z)-2-methanimidoyl-4,7-dimethyl-5-methylidene-N-propyldodeca-3,6,8-trienamide |
| SMILES | [H]/N=C/C(/C=C(\C)C(=C)/C=C(C)/C=C\CCC)C(=O)NCCC |
| InChI | InChI=1S/C19H30N2O/c1-6-8-9-10-15(3)12-16(4)17(5)13-18(14-20)19(22)21-11-7-2/h9-10,12-14,18,20H,4,6-8,11H2,1-3,5H3,(H,21,22)/b10-9-,15-12-,17-13+,20-14+ |
| InChIKey | WDMHNPOGSPHBBH-PGLNVCDTSA-N |
| XLogP | 4.58 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|