About 6-sulfanyloxyquinoxaline
6-sulfanyloxyquinoxaline (PubChem CID 123636597) has the molecular formula C8H6N2OS
and a molecular weight of 178.22 g/mol. Its IUPAC name is 6-sulfanyloxyquinoxaline.
Molecular Properties
| Compound Name | 6-sulfanyloxyquinoxaline |
| PubChem CID | 123636597 |
| Molecular Formula | C8H6N2OS |
| Molecular Weight | 178.22 g/mol |
| Exact Mass | 178.02 |
| IUPAC Name | 6-sulfanyloxyquinoxaline |
| SMILES | SOc1ccc2nccnc2c1 |
| InChI | InChI=1S/C8H6N2OS/c12-11-6-1-2-7-8(5-6)10-4-3-9-7/h1-5,12H |
| InChIKey | QOLKASKZSPOQON-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 35.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.22 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 6-sulfanyloxyquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-sulfanyloxyquinoxaline?
The IUPAC name of 6-sulfanyloxyquinoxaline (CID 123636597) is 6-sulfanyloxyquinoxaline.
What is the SMILES notation for 6-sulfanyloxyquinoxaline?
The canonical SMILES for 6-sulfanyloxyquinoxaline is SOc1ccc2nccnc2c1.
What is the InChIKey of 6-sulfanyloxyquinoxaline?
The InChIKey is QOLKASKZSPOQON-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2OS/c12-11-6-1-2-7-8(5-6)10-4-3-9-7/h1-5,12H.
What are the key properties of 6-sulfanyloxyquinoxaline?
6-sulfanyloxyquinoxaline has a molecular weight of 178.22 g/mol, XLogP of 1.85, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-sulfanyloxyquinoxaline is sourced from PubChem (CID 123636597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).