C31H37BO4 — CID 123636842
3-[(3-carboxy-2,4,5,6-tetramethylphenyl)-(2,4,6-trimethylphenyl)boranyl]-2,4,5,6-tetramethylbenzoic acid (PubChem CID 123636842) has the molecular formula C31H37BO4 and a molecular weight of 484.45 g/mol. Its IUPAC name is 3-[(3-carboxy-2,4,5,6-tetramethylphenyl)-(2,4,6-trimethylphenyl)boranyl]-2,4,5,6-tetramethylbenzoic acid.
| Compound Name | 3-[(3-carboxy-2,4,5,6-tetramethylphenyl)-(2,4,6-trimethylphenyl)boranyl]-2,4,5,6-tetramethylbenzoic acid |
|---|---|
| PubChem CID | 123636842 |
| Molecular Formula | C31H37BO4 |
| Molecular Weight | 484.45 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | 3-[(3-carboxy-2,4,5,6-tetramethylphenyl)-(2,4,6-trimethylphenyl)boranyl]-2,4,5,6-tetramethylbenzoic acid |
| SMILES | Cc1cc(C)c(B(c2c(C)c(C)c(C)c(C(=O)O)c2C)c2c(C)c(C)c(C)c(C(=O)O)c2C)c(C)c1 |
| InChI | InChI=1S/C31H37BO4/c1-14-12-15(2)27(16(3)13-14)32(28-21(8)17(4)19(6)25(23(28)10)30(33)34)29-22(9)18(5)20(7)26(24(29)11)31(35)36/h12-13H,1-11H3,(H,33,34)(H,35,36) |
| InChIKey | IOFUNUBZMQTVHT-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.45 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|