C17H12N4O3 — CID 123637083
6-[(4-phenyltriazol-1-yl)methyl]-1H-3,1-benzoxazine-2,4-dione (PubChem CID 123637083) has the molecular formula C17H12N4O3 and a molecular weight of 320.31 g/mol. Its IUPAC name is 6-[(4-phenyltriazol-1-yl)methyl]-1H-3,1-benzoxazine-2,4-dione.
| Compound Name | 6-[(4-phenyltriazol-1-yl)methyl]-1H-3,1-benzoxazine-2,4-dione |
|---|---|
| PubChem CID | 123637083 |
| Molecular Formula | C17H12N4O3 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 6-[(4-phenyltriazol-1-yl)methyl]-1H-3,1-benzoxazine-2,4-dione |
| SMILES | O=c1[nH]c2ccc(Cn3cc(-c4ccccc4)nn3)cc2c(=O)o1 |
| InChI | InChI=1S/C17H12N4O3/c22-16-13-8-11(6-7-14(13)18-17(23)24-16)9-21-10-15(19-20-21)12-4-2-1-3-5-12/h1-8,10H,9H2,(H,18,23) |
| InChIKey | PGPYHEIRLDTBHI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |