About 1'-benzhydryl-2,2-dimethyl-7-propan-2-yloxyspiro[3H-chromene-4,3'-indole]-2'-one
1'-benzhydryl-2,2-dimethyl-7-propan-2-yloxyspiro[3H-chromene-4,3'-indole]-2'-one (PubChem CID 123637195) has the molecular formula C34H33NO3
and a molecular weight of 503.64 g/mol. Its IUPAC name is 1'-benzhydryl-2,2-dimethyl-7-propan-2-yloxyspiro[3H-chromene-4,3'-indole]-2'-one.
Molecular Properties
| Compound Name | 1'-benzhydryl-2,2-dimethyl-7-propan-2-yloxyspiro[3H-chromene-4,3'-indole]-2'-one |
| PubChem CID | 123637195 |
| Molecular Formula | C34H33NO3 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | 1'-benzhydryl-2,2-dimethyl-7-propan-2-yloxyspiro[3H-chromene-4,3'-indole]-2'-one |
| SMILES | CC(C)Oc1ccc2c(c1)OC(C)(C)CC21C(=O)N(C(c2ccccc2)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C34H33NO3/c1-23(2)37-26-19-20-28-30(21-26)38-33(3,4)22-34(28)27-17-11-12-18-29(27)35(32(34)36)31(24-13-7-5-8-14-24)25-15-9-6-10-16-25/h5-21,23,31H,22H2,1-4H3 |
| InChIKey | BPZJKEYWSKQQHR-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1'-benzhydryl-2,2-dimethyl-7-propan-2-yloxyspiro[3H-chromene-4,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-benzhydryl-2,2-dimethyl-7-propan-2-yloxyspiro[3H-chromene-4,3'-indole]-2'-one?
The IUPAC name of 1'-benzhydryl-2,2-dimethyl-7-propan-2-yloxyspiro[3H-chromene-4,3'-indole]-2'-one (CID 123637195) is 1'-benzhydryl-2,2-dimethyl-7-propan-2-yloxyspiro[3H-chromene-4,3'-indole]-2'-one.
What is the SMILES notation for 1'-benzhydryl-2,2-dimethyl-7-propan-2-yloxyspiro[3H-chromene-4,3'-indole]-2'-one?
The canonical SMILES for 1'-benzhydryl-2,2-dimethyl-7-propan-2-yloxyspiro[3H-chromene-4,3'-indole]-2'-one is CC(C)Oc1ccc2c(c1)OC(C)(C)CC21C(=O)N(C(c2ccccc2)c2ccccc2)c2ccccc21.
What is the InChIKey of 1'-benzhydryl-2,2-dimethyl-7-propan-2-yloxyspiro[3H-chromene-4,3'-indole]-2'-one?
The InChIKey is BPZJKEYWSKQQHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H33NO3/c1-23(2)37-26-19-20-28-30(21-26)38-33(3,4)22-34(28)27-17-11-12-18-29(27)35(32(34)36)31(24-13-7-5-8-14-24)25-15-9-6-10-16-25/h5-21,23,31H,22H2,1-4H3.
What are the key properties of 1'-benzhydryl-2,2-dimethyl-7-propan-2-yloxyspiro[3H-chromene-4,3'-indole]-2'-one?
1'-benzhydryl-2,2-dimethyl-7-propan-2-yloxyspiro[3H-chromene-4,3'-indole]-2'-one has a molecular weight of 503.64 g/mol, XLogP of 7.46, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-benzhydryl-2,2-dimethyl-7-propan-2-yloxyspiro[3H-chromene-4,3'-indole]-2'-one is sourced from PubChem (CID 123637195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).