About bicyclo[2.2.1]heptane;ethane;2-oxo-2-(propoxymethoxy)ethanesulfonic acid
bicyclo[2.2.1]heptane;ethane;2-oxo-2-(propoxymethoxy)ethanesulfonic acid (PubChem CID 123637364) has the molecular formula C15H30O6S
and a molecular weight of 338.47 g/mol. Its IUPAC name is bicyclo[2.2.1]heptane;ethane;2-oxo-2-(propoxymethoxy)ethanesulfonic acid.
Molecular Properties
| Compound Name | bicyclo[2.2.1]heptane;ethane;2-oxo-2-(propoxymethoxy)ethanesulfonic acid |
| PubChem CID | 123637364 |
| Molecular Formula | C15H30O6S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | bicyclo[2.2.1]heptane;ethane;2-oxo-2-(propoxymethoxy)ethanesulfonic acid |
| SMILES | C1CC2CCC1C2.CC.CCCOCOC(=O)CS(=O)(=O)O |
| InChI | InChI=1S/C7H12.C6H12O6S.C2H6/c1-2-7-4-3-6(1)5-7;1-2-3-11-5-12-6(7)4-13(8,9)10;1-2/h6-7H,1-5H2;2-5H2,1H3,(H,8,9,10);1-2H3 |
| InChIKey | GILRYRVTVJHJMZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.1]heptane;ethane;2-oxo-2-(propoxymethoxy)ethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]heptane;ethane;2-oxo-2-(propoxymethoxy)ethanesulfonic acid?
The IUPAC name of bicyclo[2.2.1]heptane;ethane;2-oxo-2-(propoxymethoxy)ethanesulfonic acid (CID 123637364) is bicyclo[2.2.1]heptane;ethane;2-oxo-2-(propoxymethoxy)ethanesulfonic acid.
What is the SMILES notation for bicyclo[2.2.1]heptane;ethane;2-oxo-2-(propoxymethoxy)ethanesulfonic acid?
The canonical SMILES for bicyclo[2.2.1]heptane;ethane;2-oxo-2-(propoxymethoxy)ethanesulfonic acid is C1CC2CCC1C2.CC.CCCOCOC(=O)CS(=O)(=O)O.
What is the InChIKey of bicyclo[2.2.1]heptane;ethane;2-oxo-2-(propoxymethoxy)ethanesulfonic acid?
The InChIKey is GILRYRVTVJHJMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12.C6H12O6S.C2H6/c1-2-7-4-3-6(1)5-7;1-2-3-11-5-12-6(7)4-13(8,9)10;1-2/h6-7H,1-5H2;2-5H2,1H3,(H,8,9,10);1-2H3.
What are the key properties of bicyclo[2.2.1]heptane;ethane;2-oxo-2-(propoxymethoxy)ethanesulfonic acid?
bicyclo[2.2.1]heptane;ethane;2-oxo-2-(propoxymethoxy)ethanesulfonic acid has a molecular weight of 338.47 g/mol, XLogP of 3.02, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]heptane;ethane;2-oxo-2-(propoxymethoxy)ethanesulfonic acid is sourced from PubChem (CID 123637364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).