C26H50O4Si2 — CID 123637482
[(3aR,4R,6aS)-4-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-2-methoxy-2,3,3a,4,6,6a-hexahydrocyclopenta[b]furan-5-ylidene]methoxy-trimethylsilane (PubChem CID 123637482) has the molecular formula C26H50O4Si2 and a molecular weight of 482.85 g/mol. Its IUPAC name is [(3aR,4R,6aS)-4-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-2-methoxy-2,3,3a,4,6,6a-hexahydrocyclopenta[b]furan-5-ylidene]methoxy-trimethylsilane.
| Compound Name | [(3aR,4R,6aS)-4-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-2-methoxy-2,3,3a,4,6,6a-hexahydrocyclopenta[b]furan-5-ylidene]methoxy-trimethylsilane |
|---|---|
| PubChem CID | 123637482 |
| Molecular Formula | C26H50O4Si2 |
| Molecular Weight | 482.85 g/mol |
| Exact Mass | 482.32 |
| IUPAC Name | [(3aR,4R,6aS)-4-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]-2-methoxy-2,3,3a,4,6,6a-hexahydrocyclopenta[b]furan-5-ylidene]methoxy-trimethylsilane |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1C(=CO[Si](C)(C)C)C[C@@H]2OC(OC)C[C@@H]21)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H50O4Si2/c1-11-12-13-14-21(30-32(9,10)26(2,3)4)15-16-22-20(19-28-31(6,7)8)17-24-23(22)18-25(27-5)29-24/h15-16,19,21-25H,11-14,17-18H2,1-10H3/b16-15+,20-19?/t21-,22-,23+,24-,25?/m0/s1 |
| InChIKey | PDPKVHSHHLRAMM-LIYBNPILSA-N |
| XLogP | 7.65 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.85 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|