C13H22F2N2 — CID 123637555
2-(4,4-difluorocyclohexyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[3,2-c]pyridine (PubChem CID 123637555) has the molecular formula C13H22F2N2 and a molecular weight of 244.33 g/mol. Its IUPAC name is 2-(4,4-difluorocyclohexyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[3,2-c]pyridine.
| Compound Name | 2-(4,4-difluorocyclohexyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 123637555 |
| Molecular Formula | C13H22F2N2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 2-(4,4-difluorocyclohexyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[3,2-c]pyridine |
| SMILES | FC1(F)CCC(C2CC3CNCCC3N2)CC1 |
| InChI | InChI=1S/C13H22F2N2/c14-13(15)4-1-9(2-5-13)12-7-10-8-16-6-3-11(10)17-12/h9-12,16-17H,1-8H2 |
| InChIKey | PDTWXCLNTMFSJA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |