C30H57NO7 — CID 123637923
N-[3,5-dihydroxy-6,6,8,8-tetramethyl-1-(5,6,7-trihydroxycyclohept-3-en-1-yl)oxynonan-2-yl]-3,3,5,5-tetramethylhexanamide (PubChem CID 123637923) has the molecular formula C30H57NO7 and a molecular weight of 543.79 g/mol. Its IUPAC name is N-[3,5-dihydroxy-6,6,8,8-tetramethyl-1-(5,6,7-trihydroxycyclohept-3-en-1-yl)oxynonan-2-yl]-3,3,5,5-tetramethylhexanamide.
| Compound Name | N-[3,5-dihydroxy-6,6,8,8-tetramethyl-1-(5,6,7-trihydroxycyclohept-3-en-1-yl)oxynonan-2-yl]-3,3,5,5-tetramethylhexanamide |
|---|---|
| PubChem CID | 123637923 |
| Molecular Formula | C30H57NO7 |
| Molecular Weight | 543.79 g/mol |
| Exact Mass | 543.41 |
| IUPAC Name | N-[3,5-dihydroxy-6,6,8,8-tetramethyl-1-(5,6,7-trihydroxycyclohept-3-en-1-yl)oxynonan-2-yl]-3,3,5,5-tetramethylhexanamide |
| SMILES | CC(C)(C)CC(C)(C)CC(=O)NC(COC1CC=CC(O)C(O)C1O)C(O)CC(O)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C30H57NO7/c1-27(2,3)17-29(7,8)15-24(35)31-19(16-38-22-13-11-12-20(32)25(36)26(22)37)21(33)14-23(34)30(9,10)18-28(4,5)6/h11-12,19-23,25-26,32-34,36-37H,13-18H2,1-10H3,(H,31,35) |
| InChIKey | GYZOOPPBOPMMDV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.79 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|