C14H19N3OS — CID 123638676
8-(2,3-dihydro-1,2-benzothiazol-6-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine (PubChem CID 123638676) has the molecular formula C14H19N3OS and a molecular weight of 277.39 g/mol. Its IUPAC name is 8-(2,3-dihydro-1,2-benzothiazol-6-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine.
| Compound Name | 8-(2,3-dihydro-1,2-benzothiazol-6-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 123638676 |
| Molecular Formula | C14H19N3OS |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 8-(2,3-dihydro-1,2-benzothiazol-6-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
| SMILES | c1cc2c(cc1N1CCN3CCOCC3C1)SNC2 |
| InChI | InChI=1S/C14H19N3OS/c1-2-12(7-14-11(1)8-15-19-14)17-4-3-16-5-6-18-10-13(16)9-17/h1-2,7,13,15H,3-6,8-10H2 |
| InChIKey | GNURVLFVDYKTNL-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|