C13H17FN4O — CID 123639058
3-[8-(5-fluoropyrimidin-2-yl)-3,8-diazabicyclo[3.2.1]octan-3-yl]propanal (PubChem CID 123639058) has the molecular formula C13H17FN4O and a molecular weight of 264.30 g/mol. Its IUPAC name is 3-[8-(5-fluoropyrimidin-2-yl)-3,8-diazabicyclo[3.2.1]octan-3-yl]propanal.
| Compound Name | 3-[8-(5-fluoropyrimidin-2-yl)-3,8-diazabicyclo[3.2.1]octan-3-yl]propanal |
|---|---|
| PubChem CID | 123639058 |
| Molecular Formula | C13H17FN4O |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 3-[8-(5-fluoropyrimidin-2-yl)-3,8-diazabicyclo[3.2.1]octan-3-yl]propanal |
| SMILES | O=CCCN1CC2CCC(C1)N2c1ncc(F)cn1 |
| InChI | InChI=1S/C13H17FN4O/c14-10-6-15-13(16-7-10)18-11-2-3-12(18)9-17(8-11)4-1-5-19/h5-7,11-12H,1-4,8-9H2 |
| InChIKey | LUAXLQZBDMTNOD-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|