About 2-[N-(3-hydroxypropyl)-C-(2-methylpropyl)carbonimidoyl]-5,5-dimethylcyclohexane-1,3-dione
2-[N-(3-hydroxypropyl)-C-(2-methylpropyl)carbonimidoyl]-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 123639132) has the molecular formula C16H27NO3
and a molecular weight of 281.40 g/mol. Its IUPAC name is 2-[N-(3-hydroxypropyl)-C-(2-methylpropyl)carbonimidoyl]-5,5-dimethylcyclohexane-1,3-dione.
Molecular Properties
| Compound Name | 2-[N-(3-hydroxypropyl)-C-(2-methylpropyl)carbonimidoyl]-5,5-dimethylcyclohexane-1,3-dione |
| PubChem CID | 123639132 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 2-[N-(3-hydroxypropyl)-C-(2-methylpropyl)carbonimidoyl]-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | CC(C)C/C(=N\CCCO)C1C(=O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C16H27NO3/c1-11(2)8-12(17-6-5-7-18)15-13(19)9-16(3,4)10-14(15)20/h11,15,18H,5-10H2,1-4H3/b17-12+ |
| InChIKey | ZSQLPTLLAYIJKK-SFQUDFHCSA-N |
| XLogP | 2.43 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[N-(3-hydroxypropyl)-C-(2-methylpropyl)carbonimidoyl]-5,5-dimethylcyclohexane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[N-(3-hydroxypropyl)-C-(2-methylpropyl)carbonimidoyl]-5,5-dimethylcyclohexane-1,3-dione?
The IUPAC name of 2-[N-(3-hydroxypropyl)-C-(2-methylpropyl)carbonimidoyl]-5,5-dimethylcyclohexane-1,3-dione (CID 123639132) is 2-[N-(3-hydroxypropyl)-C-(2-methylpropyl)carbonimidoyl]-5,5-dimethylcyclohexane-1,3-dione.
What is the SMILES notation for 2-[N-(3-hydroxypropyl)-C-(2-methylpropyl)carbonimidoyl]-5,5-dimethylcyclohexane-1,3-dione?
The canonical SMILES for 2-[N-(3-hydroxypropyl)-C-(2-methylpropyl)carbonimidoyl]-5,5-dimethylcyclohexane-1,3-dione is CC(C)C/C(=N\CCCO)C1C(=O)CC(C)(C)CC1=O.
What is the InChIKey of 2-[N-(3-hydroxypropyl)-C-(2-methylpropyl)carbonimidoyl]-5,5-dimethylcyclohexane-1,3-dione?
The InChIKey is ZSQLPTLLAYIJKK-SFQUDFHCSA-N. The full InChI is InChI=1S/C16H27NO3/c1-11(2)8-12(17-6-5-7-18)15-13(19)9-16(3,4)10-14(15)20/h11,15,18H,5-10H2,1-4H3/b17-12+.
What are the key properties of 2-[N-(3-hydroxypropyl)-C-(2-methylpropyl)carbonimidoyl]-5,5-dimethylcyclohexane-1,3-dione?
2-[N-(3-hydroxypropyl)-C-(2-methylpropyl)carbonimidoyl]-5,5-dimethylcyclohexane-1,3-dione has a molecular weight of 281.40 g/mol, XLogP of 2.43, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[N-(3-hydroxypropyl)-C-(2-methylpropyl)carbonimidoyl]-5,5-dimethylcyclohexane-1,3-dione is sourced from PubChem (CID 123639132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).