C28H35FN4O2S — CID 123639696
4-[[(1R,2R)-2-[[4-(6-fluoro-1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5-diol (PubChem CID 123639696) has the molecular formula C28H35FN4O2S and a molecular weight of 510.68 g/mol. Its IUPAC name is 4-[[(1R,2R)-2-[[4-(6-fluoro-1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5-diol.
| Compound Name | 4-[[(1R,2R)-2-[[4-(6-fluoro-1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5-diol |
|---|---|
| PubChem CID | 123639696 |
| Molecular Formula | C28H35FN4O2S |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | 4-[[(1R,2R)-2-[[4-(6-fluoro-1,2-benzothiazol-3-yl)piperazin-1-yl]methyl]cyclohexyl]methyl]-4-azatricyclo[5.2.1.02,6]deca-2,5-diene-3,5-diol |
| SMILES | Oc1c2c(c(O)n1C[C@@H]1CCCC[C@H]1CN1CCN(c3nsc4cc(F)ccc34)CC1)C1CCC2C1 |
| InChI | InChI=1S/C28H35FN4O2S/c29-21-7-8-22-23(14-21)36-30-26(22)32-11-9-31(10-12-32)15-19-3-1-2-4-20(19)16-33-27(34)24-17-5-6-18(13-17)25(24)28(33)35/h7-8,14,17-20,34-35H,1-6,9-13,15-16H2/t17?,18?,19-,20-/m0/s1 |
| InChIKey | OFLFBHUVVPBRJM-GUMHCPJTSA-N |
| XLogP | 5.64 |
| TPSA | 64.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |